C14H19BrN2OS — CID 119302976
N-[4-(4-bromophenyl)butan-2-yl]-1,3-thiazolidine-4-carboxamide (PubChem CID 119302976) has the molecular formula C14H19BrN2OS and a molecular weight of 343.29 g/mol. Its IUPAC name is N-[4-(4-bromophenyl)butan-2-yl]-1,3-thiazolidine-4-carboxamide.
| Compound Name | N-[4-(4-bromophenyl)butan-2-yl]-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 119302976 |
| Molecular Formula | C14H19BrN2OS |
| Molecular Weight | 343.29 g/mol |
| Exact Mass | 342.04 |
| IUPAC Name | N-[4-(4-bromophenyl)butan-2-yl]-1,3-thiazolidine-4-carboxamide |
| SMILES | CC(CCc1ccc(Br)cc1)NC(=O)C1CSCN1 |
| InChI | InChI=1S/C14H19BrN2OS/c1-10(17-14(18)13-8-19-9-16-13)2-3-11-4-6-12(15)7-5-11/h4-7,10,13,16H,2-3,8-9H2,1H3,(H,17,18) |
| InChIKey | WGFQEIIREYXSKL-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.29 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |