C12H15BrN2OS — CID 81291659
N-(4-bromo-2-ethylphenyl)-1,3-thiazolidine-4-carboxamide (PubChem CID 81291659) has the molecular formula C12H15BrN2OS and a molecular weight of 315.24 g/mol. Its IUPAC name is N-(4-bromo-2-ethylphenyl)-1,3-thiazolidine-4-carboxamide.
| Compound Name | N-(4-bromo-2-ethylphenyl)-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 81291659 |
| Molecular Formula | C12H15BrN2OS |
| Molecular Weight | 315.24 g/mol |
| Exact Mass | 314.01 |
| IUPAC Name | N-(4-bromo-2-ethylphenyl)-1,3-thiazolidine-4-carboxamide |
| SMILES | CCc1cc(Br)ccc1NC(=O)C1CSCN1 |
| InChI | InChI=1S/C12H15BrN2OS/c1-2-8-5-9(13)3-4-10(8)15-12(16)11-6-17-7-14-11/h3-5,11,14H,2,6-7H2,1H3,(H,15,16) |
| InChIKey | USXCNQYOTYEMIX-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.24 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |