C12H15BrN2OS — CID 107574265
N-(4-bromo-3,5-dimethylphenyl)-1,3-thiazolidine-4-carboxamide (PubChem CID 107574265) has the molecular formula C12H15BrN2OS and a molecular weight of 315.24 g/mol. Its IUPAC name is N-(4-bromo-3,5-dimethylphenyl)-1,3-thiazolidine-4-carboxamide.
| Compound Name | N-(4-bromo-3,5-dimethylphenyl)-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 107574265 |
| Molecular Formula | C12H15BrN2OS |
| Molecular Weight | 315.24 g/mol |
| Exact Mass | 314.01 |
| IUPAC Name | N-(4-bromo-3,5-dimethylphenyl)-1,3-thiazolidine-4-carboxamide |
| SMILES | Cc1cc(NC(=O)C2CSCN2)cc(C)c1Br |
| InChI | InChI=1S/C12H15BrN2OS/c1-7-3-9(4-8(2)11(7)13)15-12(16)10-5-17-6-14-10/h3-4,10,14H,5-6H2,1-2H3,(H,15,16) |
| InChIKey | JRQOTBWXSPRPKJ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.24 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |