C11H14N2OS — CID 24689839
N-(3-methylphenyl)-1,3-thiazolidine-4-carboxamide (PubChem CID 24689839) has the molecular formula C11H14N2OS and a molecular weight of 222.31 g/mol. Its IUPAC name is N-(3-methylphenyl)-1,3-thiazolidine-4-carboxamide.
| Compound Name | N-(3-methylphenyl)-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 24689839 |
| Molecular Formula | C11H14N2OS |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | N-(3-methylphenyl)-1,3-thiazolidine-4-carboxamide |
| SMILES | Cc1cccc(NC(=O)C2CSCN2)c1 |
| InChI | InChI=1S/C11H14N2OS/c1-8-3-2-4-9(5-8)13-11(14)10-6-15-7-12-10/h2-5,10,12H,6-7H2,1H3,(H,13,14) |
| InChIKey | XLMXCVHKDZIMAH-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |