C14H15N3OS — CID 43713195
N-(3-pyrrol-1-ylphenyl)-1,3-thiazolidine-4-carboxamide (PubChem CID 43713195) has the molecular formula C14H15N3OS and a molecular weight of 273.36 g/mol. Its IUPAC name is N-(3-pyrrol-1-ylphenyl)-1,3-thiazolidine-4-carboxamide.
| Compound Name | N-(3-pyrrol-1-ylphenyl)-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 43713195 |
| Molecular Formula | C14H15N3OS |
| Molecular Weight | 273.36 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | N-(3-pyrrol-1-ylphenyl)-1,3-thiazolidine-4-carboxamide |
| SMILES | O=C(Nc1cccc(-n2cccc2)c1)C1CSCN1 |
| InChI | InChI=1S/C14H15N3OS/c18-14(13-9-19-10-15-13)16-11-4-3-5-12(8-11)17-6-1-2-7-17/h1-8,13,15H,9-10H2,(H,16,18) |
| InChIKey | XARGIAFLCKHOLQ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 46.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.36 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |