C13H14N4OS — CID 110668512
N-[3-(1H-imidazol-5-yl)phenyl]-1,3-thiazolidine-4-carboxamide (PubChem CID 110668512) has the molecular formula C13H14N4OS and a molecular weight of 274.35 g/mol. Its IUPAC name is N-[3-(1H-imidazol-5-yl)phenyl]-1,3-thiazolidine-4-carboxamide.
| Compound Name | N-[3-(1H-imidazol-5-yl)phenyl]-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 110668512 |
| Molecular Formula | C13H14N4OS |
| Molecular Weight | 274.35 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | N-[3-(1H-imidazol-5-yl)phenyl]-1,3-thiazolidine-4-carboxamide |
| SMILES | O=C(Nc1cccc(-c2cnc[nH]2)c1)C1CSCN1 |
| InChI | InChI=1S/C13H14N4OS/c18-13(12-6-19-8-16-12)17-10-3-1-2-9(4-10)11-5-14-7-15-11/h1-5,7,12,16H,6,8H2,(H,14,15)(H,17,18) |
| InChIKey | UIJUVUYTJWNECM-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.35 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |