C9H11N3OS — CID 24692510
N-pyridin-4-yl-1,3-thiazolidine-4-carboxamide (PubChem CID 24692510) has the molecular formula C9H11N3OS and a molecular weight of 209.27 g/mol. Its IUPAC name is N-pyridin-4-yl-1,3-thiazolidine-4-carboxamide.
| Compound Name | N-pyridin-4-yl-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 24692510 |
| Molecular Formula | C9H11N3OS |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.06 |
| IUPAC Name | N-pyridin-4-yl-1,3-thiazolidine-4-carboxamide |
| SMILES | O=C(Nc1ccncc1)C1CSCN1 |
| InChI | InChI=1S/C9H11N3OS/c13-9(8-5-14-6-11-8)12-7-1-3-10-4-2-7/h1-4,8,11H,5-6H2,(H,10,12,13) |
| InChIKey | ILQMIRBCPCKQDZ-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |