C10H13N3O — CID 18072890
N-pyridin-4-ylpyrrolidine-2-carboxamide (PubChem CID 18072890) has the molecular formula C10H13N3O and a molecular weight of 191.23 g/mol. Its IUPAC name is N-pyridin-4-ylpyrrolidine-2-carboxamide.
| Compound Name | N-pyridin-4-ylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 18072890 |
| Molecular Formula | C10H13N3O |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | N-pyridin-4-ylpyrrolidine-2-carboxamide |
| SMILES | O=C(Nc1ccncc1)C1CCCN1 |
| InChI | InChI=1S/C10H13N3O/c14-10(9-2-1-5-12-9)13-8-3-6-11-7-4-8/h3-4,6-7,9,12H,1-2,5H2,(H,11,13,14) |
| InChIKey | QKANLPJIQRFDKI-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |