C11H13IN2O — CID 28881297
(2R)-N-(4-iodophenyl)pyrrolidine-2-carboxamide (PubChem CID 28881297) has the molecular formula C11H13IN2O and a molecular weight of 316.14 g/mol. Its IUPAC name is (2R)-N-(4-iodophenyl)pyrrolidine-2-carboxamide.
| Compound Name | (2R)-N-(4-iodophenyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 28881297 |
| Molecular Formula | C11H13IN2O |
| Molecular Weight | 316.14 g/mol |
| Exact Mass | 316.01 |
| IUPAC Name | (2R)-N-(4-iodophenyl)pyrrolidine-2-carboxamide |
| SMILES | O=C(Nc1ccc(I)cc1)[C@H]1CCCN1 |
| InChI | InChI=1S/C11H13IN2O/c12-8-3-5-9(6-4-8)14-11(15)10-2-1-7-13-10/h3-6,10,13H,1-2,7H2,(H,14,15)/t10-/m1/s1 |
| InChIKey | YQYNQDOMHGOMIQ-SNVBAGLBSA-N |
| XLogP | 1.98 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.14 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|