C15H17ClN4O — CID 119328472
N-(4-pyrimidin-5-ylphenyl)pyrrolidine-2-carboxamide;hydrochloride (PubChem CID 119328472) has the molecular formula C15H17ClN4O and a molecular weight of 304.78 g/mol. Its IUPAC name is N-(4-pyrimidin-5-ylphenyl)pyrrolidine-2-carboxamide;hydrochloride.
| Compound Name | N-(4-pyrimidin-5-ylphenyl)pyrrolidine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119328472 |
| Molecular Formula | C15H17ClN4O |
| Molecular Weight | 304.78 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | N-(4-pyrimidin-5-ylphenyl)pyrrolidine-2-carboxamide;hydrochloride |
| SMILES | Cl.O=C(Nc1ccc(-c2cncnc2)cc1)C1CCCN1 |
| InChI | InChI=1S/C15H16N4O.ClH/c20-15(14-2-1-7-18-14)19-13-5-3-11(4-6-13)12-8-16-10-17-9-12;/h3-6,8-10,14,18H,1-2,7H2,(H,19,20);1H |
| InChIKey | VCWJBIDYFDYJHP-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.78 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |