C12H16N2OS — CID 82906077
N-(3-methylphenyl)thiomorpholine-3-carboxamide (PubChem CID 82906077) has the molecular formula C12H16N2OS and a molecular weight of 236.34 g/mol. Its IUPAC name is N-(3-methylphenyl)thiomorpholine-3-carboxamide.
| Compound Name | N-(3-methylphenyl)thiomorpholine-3-carboxamide |
|---|---|
| PubChem CID | 82906077 |
| Molecular Formula | C12H16N2OS |
| Molecular Weight | 236.34 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | N-(3-methylphenyl)thiomorpholine-3-carboxamide |
| SMILES | Cc1cccc(NC(=O)C2CSCCN2)c1 |
| InChI | InChI=1S/C12H16N2OS/c1-9-3-2-4-10(7-9)14-12(15)11-8-16-6-5-13-11/h2-4,7,11,13H,5-6,8H2,1H3,(H,14,15) |
| InChIKey | FYCMWBLCCZIGFS-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.34 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |