C10H13N3OS — CID 82905944
N-pyridin-3-ylthiomorpholine-3-carboxamide (PubChem CID 82905944) has the molecular formula C10H13N3OS and a molecular weight of 223.30 g/mol. Its IUPAC name is N-pyridin-3-ylthiomorpholine-3-carboxamide.
| Compound Name | N-pyridin-3-ylthiomorpholine-3-carboxamide |
|---|---|
| PubChem CID | 82905944 |
| Molecular Formula | C10H13N3OS |
| Molecular Weight | 223.30 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | N-pyridin-3-ylthiomorpholine-3-carboxamide |
| SMILES | O=C(Nc1cccnc1)C1CSCCN1 |
| InChI | InChI=1S/C10H13N3OS/c14-10(9-7-15-5-4-12-9)13-8-2-1-3-11-6-8/h1-3,6,9,12H,4-5,7H2,(H,13,14) |
| InChIKey | POWFXFKYDREBPC-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.30 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |