C11H12F2N2OS — CID 82906459
N-(3,4-difluorophenyl)thiomorpholine-3-carboxamide (PubChem CID 82906459) has the molecular formula C11H12F2N2OS and a molecular weight of 258.29 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)thiomorpholine-3-carboxamide.
| Compound Name | N-(3,4-difluorophenyl)thiomorpholine-3-carboxamide |
|---|---|
| PubChem CID | 82906459 |
| Molecular Formula | C11H12F2N2OS |
| Molecular Weight | 258.29 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | N-(3,4-difluorophenyl)thiomorpholine-3-carboxamide |
| SMILES | O=C(Nc1ccc(F)c(F)c1)C1CSCCN1 |
| InChI | InChI=1S/C11H12F2N2OS/c12-8-2-1-7(5-9(8)13)15-11(16)10-6-17-4-3-14-10/h1-2,5,10,14H,3-4,6H2,(H,15,16) |
| InChIKey | IMVHTASWIIPWLG-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.29 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |