C11H16N4O3S2 — CID 82908775
N-[3-(sulfamoylamino)phenyl]thiomorpholine-3-carboxamide (PubChem CID 82908775) has the molecular formula C11H16N4O3S2 and a molecular weight of 316.41 g/mol. Its IUPAC name is N-[3-(sulfamoylamino)phenyl]thiomorpholine-3-carboxamide.
| Compound Name | N-[3-(sulfamoylamino)phenyl]thiomorpholine-3-carboxamide |
|---|---|
| PubChem CID | 82908775 |
| Molecular Formula | C11H16N4O3S2 |
| Molecular Weight | 316.41 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | N-[3-(sulfamoylamino)phenyl]thiomorpholine-3-carboxamide |
| SMILES | NS(=O)(=O)Nc1cccc(NC(=O)C2CSCCN2)c1 |
| InChI | InChI=1S/C11H16N4O3S2/c12-20(17,18)15-9-3-1-2-8(6-9)14-11(16)10-7-19-5-4-13-10/h1-3,6,10,13,15H,4-5,7H2,(H,14,16)(H2,12,17,18) |
| InChIKey | LHMRQUCYQJOTKU-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.41 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |