C13H19N3O3S2 — CID 119329973
N-[3-(propylsulfonylamino)phenyl]-1,3-thiazolidine-4-carboxamide (PubChem CID 119329973) has the molecular formula C13H19N3O3S2 and a molecular weight of 329.45 g/mol. Its IUPAC name is N-[3-(propylsulfonylamino)phenyl]-1,3-thiazolidine-4-carboxamide.
| Compound Name | N-[3-(propylsulfonylamino)phenyl]-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 119329973 |
| Molecular Formula | C13H19N3O3S2 |
| Molecular Weight | 329.45 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | N-[3-(propylsulfonylamino)phenyl]-1,3-thiazolidine-4-carboxamide |
| SMILES | CCCS(=O)(=O)Nc1cccc(NC(=O)C2CSCN2)c1 |
| InChI | InChI=1S/C13H19N3O3S2/c1-2-6-21(18,19)16-11-5-3-4-10(7-11)15-13(17)12-8-20-9-14-12/h3-5,7,12,14,16H,2,6,8-9H2,1H3,(H,15,17) |
| InChIKey | NCBAZTDEDJTYKH-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.45 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |