C14H21N3O3S2 — CID 119270867
N-[3-(tert-butylsulfamoyl)phenyl]-1,3-thiazolidine-4-carboxamide (PubChem CID 119270867) has the molecular formula C14H21N3O3S2 and a molecular weight of 343.47 g/mol. Its IUPAC name is N-[3-(tert-butylsulfamoyl)phenyl]-1,3-thiazolidine-4-carboxamide.
| Compound Name | N-[3-(tert-butylsulfamoyl)phenyl]-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 119270867 |
| Molecular Formula | C14H21N3O3S2 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | N-[3-(tert-butylsulfamoyl)phenyl]-1,3-thiazolidine-4-carboxamide |
| SMILES | CC(C)(C)NS(=O)(=O)c1cccc(NC(=O)C2CSCN2)c1 |
| InChI | InChI=1S/C14H21N3O3S2/c1-14(2,3)17-22(19,20)11-6-4-5-10(7-11)16-13(18)12-8-21-9-15-12/h4-7,12,15,17H,8-9H2,1-3H3,(H,16,18) |
| InChIKey | MVAQVGWMRLPHNP-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |