C15H23N3O4S — CID 119688772
N-[3-(tert-butylsulfamoyl)phenyl]morpholine-3-carboxamide (PubChem CID 119688772) has the molecular formula C15H23N3O4S and a molecular weight of 341.43 g/mol. Its IUPAC name is N-[3-(tert-butylsulfamoyl)phenyl]morpholine-3-carboxamide.
| Compound Name | N-[3-(tert-butylsulfamoyl)phenyl]morpholine-3-carboxamide |
|---|---|
| PubChem CID | 119688772 |
| Molecular Formula | C15H23N3O4S |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | N-[3-(tert-butylsulfamoyl)phenyl]morpholine-3-carboxamide |
| SMILES | CC(C)(C)NS(=O)(=O)c1cccc(NC(=O)C2COCCN2)c1 |
| InChI | InChI=1S/C15H23N3O4S/c1-15(2,3)18-23(20,21)12-6-4-5-11(9-12)17-14(19)13-10-22-8-7-16-13/h4-6,9,13,16,18H,7-8,10H2,1-3H3,(H,17,19) |
| InChIKey | YTVUSULLNNVIRV-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |