C17H25N3O3S2 — CID 119329159
N-[3-[cyclohexyl(methyl)sulfamoyl]phenyl]-1,3-thiazolidine-4-carboxamide (PubChem CID 119329159) has the molecular formula C17H25N3O3S2 and a molecular weight of 383.54 g/mol. Its IUPAC name is N-[3-[cyclohexyl(methyl)sulfamoyl]phenyl]-1,3-thiazolidine-4-carboxamide.
| Compound Name | N-[3-[cyclohexyl(methyl)sulfamoyl]phenyl]-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 119329159 |
| Molecular Formula | C17H25N3O3S2 |
| Molecular Weight | 383.54 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | N-[3-[cyclohexyl(methyl)sulfamoyl]phenyl]-1,3-thiazolidine-4-carboxamide |
| SMILES | CN(C1CCCCC1)S(=O)(=O)c1cccc(NC(=O)C2CSCN2)c1 |
| InChI | InChI=1S/C17H25N3O3S2/c1-20(14-7-3-2-4-8-14)25(22,23)15-9-5-6-13(10-15)19-17(21)16-11-24-12-18-16/h5-6,9-10,14,16,18H,2-4,7-8,11-12H2,1H3,(H,19,21) |
| InChIKey | ZVDTXLQEAPBQNW-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.54 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |