C12H17N3O3S2 — CID 43702511
N-[4-(dimethylsulfamoyl)phenyl]-1,3-thiazolidine-4-carboxamide (PubChem CID 43702511) has the molecular formula C12H17N3O3S2 and a molecular weight of 315.42 g/mol. Its IUPAC name is N-[4-(dimethylsulfamoyl)phenyl]-1,3-thiazolidine-4-carboxamide.
| Compound Name | N-[4-(dimethylsulfamoyl)phenyl]-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 43702511 |
| Molecular Formula | C12H17N3O3S2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | N-[4-(dimethylsulfamoyl)phenyl]-1,3-thiazolidine-4-carboxamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(NC(=O)C2CSCN2)cc1 |
| InChI | InChI=1S/C12H17N3O3S2/c1-15(2)20(17,18)10-5-3-9(4-6-10)14-12(16)11-7-19-8-13-11/h3-6,11,13H,7-8H2,1-2H3,(H,14,16) |
| InChIKey | OICJKHBGMHKNPP-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |