C11H14BrN3O3S2 — CID 82908517
N-(2-bromo-4-sulfamoylphenyl)thiomorpholine-3-carboxamide (PubChem CID 82908517) has the molecular formula C11H14BrN3O3S2 and a molecular weight of 380.29 g/mol. Its IUPAC name is N-(2-bromo-4-sulfamoylphenyl)thiomorpholine-3-carboxamide.
| Compound Name | N-(2-bromo-4-sulfamoylphenyl)thiomorpholine-3-carboxamide |
|---|---|
| PubChem CID | 82908517 |
| Molecular Formula | C11H14BrN3O3S2 |
| Molecular Weight | 380.29 g/mol |
| Exact Mass | 378.97 |
| IUPAC Name | N-(2-bromo-4-sulfamoylphenyl)thiomorpholine-3-carboxamide |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)C2CSCCN2)c(Br)c1 |
| InChI | InChI=1S/C11H14BrN3O3S2/c12-8-5-7(20(13,17)18)1-2-9(8)15-11(16)10-6-19-4-3-14-10/h1-2,5,10,14H,3-4,6H2,(H,15,16)(H2,13,17,18) |
| InChIKey | UOGUVGPMZSDFHJ-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.29 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |