C11H10BrN3OS — CID 43709146
N-(2-bromo-4-cyanophenyl)-1,3-thiazolidine-4-carboxamide (PubChem CID 43709146) has the molecular formula C11H10BrN3OS and a molecular weight of 312.19 g/mol. Its IUPAC name is N-(2-bromo-4-cyanophenyl)-1,3-thiazolidine-4-carboxamide.
| Compound Name | N-(2-bromo-4-cyanophenyl)-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 43709146 |
| Molecular Formula | C11H10BrN3OS |
| Molecular Weight | 312.19 g/mol |
| Exact Mass | 310.97 |
| IUPAC Name | N-(2-bromo-4-cyanophenyl)-1,3-thiazolidine-4-carboxamide |
| SMILES | N#Cc1ccc(NC(=O)C2CSCN2)c(Br)c1 |
| InChI | InChI=1S/C11H10BrN3OS/c12-8-3-7(4-13)1-2-9(8)15-11(16)10-5-17-6-14-10/h1-3,10,14H,5-6H2,(H,15,16) |
| InChIKey | MKSFYOMDFSZGJI-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.19 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |