C10H10ClF3N2OS — CID 119281208
N-(2,4,5-trifluorophenyl)-1,3-thiazolidine-4-carboxamide;hydrochloride (PubChem CID 119281208) has the molecular formula C10H10ClF3N2OS and a molecular weight of 298.72 g/mol. Its IUPAC name is N-(2,4,5-trifluorophenyl)-1,3-thiazolidine-4-carboxamide;hydrochloride.
| Compound Name | N-(2,4,5-trifluorophenyl)-1,3-thiazolidine-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119281208 |
| Molecular Formula | C10H10ClF3N2OS |
| Molecular Weight | 298.72 g/mol |
| Exact Mass | 298.02 |
| IUPAC Name | N-(2,4,5-trifluorophenyl)-1,3-thiazolidine-4-carboxamide;hydrochloride |
| SMILES | Cl.O=C(Nc1cc(F)c(F)cc1F)C1CSCN1 |
| InChI | InChI=1S/C10H9F3N2OS.ClH/c11-5-1-7(13)8(2-6(5)12)15-10(16)9-3-17-4-14-9;/h1-2,9,14H,3-4H2,(H,15,16);1H |
| InChIKey | AWVFLEXIPNWVSQ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.72 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|