C16H16N2OS — CID 24694917
N-(2-phenylphenyl)-1,3-thiazolidine-4-carboxamide (PubChem CID 24694917) has the molecular formula C16H16N2OS and a molecular weight of 284.38 g/mol. Its IUPAC name is N-(2-phenylphenyl)-1,3-thiazolidine-4-carboxamide.
| Compound Name | N-(2-phenylphenyl)-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 24694917 |
| Molecular Formula | C16H16N2OS |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | N-(2-phenylphenyl)-1,3-thiazolidine-4-carboxamide |
| SMILES | O=C(Nc1ccccc1-c1ccccc1)C1CSCN1 |
| InChI | InChI=1S/C16H16N2OS/c19-16(15-10-20-11-17-15)18-14-9-5-4-8-13(14)12-6-2-1-3-7-12/h1-9,15,17H,10-11H2,(H,18,19) |
| InChIKey | XVJBDIXVTYGNOK-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |