C11H14N2O2S — CID 79602563
N-(2-hydroxy-3-methylphenyl)-1,3-thiazolidine-4-carboxamide (PubChem CID 79602563) has the molecular formula C11H14N2O2S and a molecular weight of 238.31 g/mol. Its IUPAC name is N-(2-hydroxy-3-methylphenyl)-1,3-thiazolidine-4-carboxamide.
| Compound Name | N-(2-hydroxy-3-methylphenyl)-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 79602563 |
| Molecular Formula | C11H14N2O2S |
| Molecular Weight | 238.31 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | N-(2-hydroxy-3-methylphenyl)-1,3-thiazolidine-4-carboxamide |
| SMILES | Cc1cccc(NC(=O)C2CSCN2)c1O |
| InChI | InChI=1S/C11H14N2O2S/c1-7-3-2-4-8(10(7)14)13-11(15)9-5-16-6-12-9/h2-4,9,12,14H,5-6H2,1H3,(H,13,15) |
| InChIKey | WCTUGWDCQSKNFL-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.31 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|