C11H14N2OS2 — CID 43702716
N-(2-methylsulfanylphenyl)-1,3-thiazolidine-4-carboxamide (PubChem CID 43702716) has the molecular formula C11H14N2OS2 and a molecular weight of 254.38 g/mol. Its IUPAC name is N-(2-methylsulfanylphenyl)-1,3-thiazolidine-4-carboxamide.
| Compound Name | N-(2-methylsulfanylphenyl)-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 43702716 |
| Molecular Formula | C11H14N2OS2 |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.05 |
| IUPAC Name | N-(2-methylsulfanylphenyl)-1,3-thiazolidine-4-carboxamide |
| SMILES | CSc1ccccc1NC(=O)C1CSCN1 |
| InChI | InChI=1S/C11H14N2OS2/c1-15-10-5-3-2-4-8(10)13-11(14)9-6-16-7-12-9/h2-5,9,12H,6-7H2,1H3,(H,13,14) |
| InChIKey | JVJJUJLWRFSHCJ-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |