C13H18N2OS2 — CID 82909130
N-(2-ethylsulfanylphenyl)thiomorpholine-3-carboxamide (PubChem CID 82909130) has the molecular formula C13H18N2OS2 and a molecular weight of 282.43 g/mol. Its IUPAC name is N-(2-ethylsulfanylphenyl)thiomorpholine-3-carboxamide.
| Compound Name | N-(2-ethylsulfanylphenyl)thiomorpholine-3-carboxamide |
|---|---|
| PubChem CID | 82909130 |
| Molecular Formula | C13H18N2OS2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | N-(2-ethylsulfanylphenyl)thiomorpholine-3-carboxamide |
| SMILES | CCSc1ccccc1NC(=O)C1CSCCN1 |
| InChI | InChI=1S/C13H18N2OS2/c1-2-18-12-6-4-3-5-10(12)15-13(16)11-9-17-8-7-14-11/h3-6,11,14H,2,7-9H2,1H3,(H,15,16) |
| InChIKey | IUYAHBINYHFKCA-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |