C13H17ClN2OS — CID 154915150
N-(2-ethylsulfanylphenyl)-2,5-dihydro-1H-pyrrole-2-carboxamide;hydrochloride (PubChem CID 154915150) has the molecular formula C13H17ClN2OS and a molecular weight of 284.81 g/mol. Its IUPAC name is N-(2-ethylsulfanylphenyl)-2,5-dihydro-1H-pyrrole-2-carboxamide;hydrochloride.
| Compound Name | N-(2-ethylsulfanylphenyl)-2,5-dihydro-1H-pyrrole-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 154915150 |
| Molecular Formula | C13H17ClN2OS |
| Molecular Weight | 284.81 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | N-(2-ethylsulfanylphenyl)-2,5-dihydro-1H-pyrrole-2-carboxamide;hydrochloride |
| SMILES | CCSc1ccccc1NC(=O)C1C=CCN1.Cl |
| InChI | InChI=1S/C13H16N2OS.ClH/c1-2-17-12-8-4-3-6-10(12)15-13(16)11-7-5-9-14-11;/h3-8,11,14H,2,9H2,1H3,(H,15,16);1H |
| InChIKey | CBQBQKZMAIXKQA-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.81 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|