C15H22N2O3S2 — CID 94624136
(2R)-N-(2-ethylsulfanylphenyl)-1-methylsulfonylpiperidine-2-carboxamide (PubChem CID 94624136) has the molecular formula C15H22N2O3S2 and a molecular weight of 342.49 g/mol. Its IUPAC name is (2R)-N-(2-ethylsulfanylphenyl)-1-methylsulfonylpiperidine-2-carboxamide.
| Compound Name | (2R)-N-(2-ethylsulfanylphenyl)-1-methylsulfonylpiperidine-2-carboxamide |
|---|---|
| PubChem CID | 94624136 |
| Molecular Formula | C15H22N2O3S2 |
| Molecular Weight | 342.49 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | (2R)-N-(2-ethylsulfanylphenyl)-1-methylsulfonylpiperidine-2-carboxamide |
| SMILES | CCSc1ccccc1NC(=O)[C@H]1CCCCN1S(C)(=O)=O |
| InChI | InChI=1S/C15H22N2O3S2/c1-3-21-14-10-5-4-8-12(14)16-15(18)13-9-6-7-11-17(13)22(2,19)20/h4-5,8,10,13H,3,6-7,9,11H2,1-2H3,(H,16,18)/t13-/m1/s1 |
| InChIKey | IHUCEHDGXABDGY-CYBMUJFWSA-N |
| XLogP | 2.55 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.49 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |