C13H16N2O2S2 — CID 71798034
N-(2-methylsulfanylphenyl)-5-oxo-1,4-thiazepane-3-carboxamide (PubChem CID 71798034) has the molecular formula C13H16N2O2S2 and a molecular weight of 296.42 g/mol. Its IUPAC name is N-(2-methylsulfanylphenyl)-5-oxo-1,4-thiazepane-3-carboxamide.
| Compound Name | N-(2-methylsulfanylphenyl)-5-oxo-1,4-thiazepane-3-carboxamide |
|---|---|
| PubChem CID | 71798034 |
| Molecular Formula | C13H16N2O2S2 |
| Molecular Weight | 296.42 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | N-(2-methylsulfanylphenyl)-5-oxo-1,4-thiazepane-3-carboxamide |
| SMILES | CSc1ccccc1NC(=O)C1CSCCC(=O)N1 |
| InChI | InChI=1S/C13H16N2O2S2/c1-18-11-5-3-2-4-9(11)15-13(17)10-8-19-7-6-12(16)14-10/h2-5,10H,6-8H2,1H3,(H,14,16)(H,15,17) |
| InChIKey | PSKRFHBQPDLYJL-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.42 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |