C12H12F2N2O2S — CID 95986397
(3S)-N-(2,5-difluorophenyl)-5-oxo-1,4-thiazepane-3-carboxamide (PubChem CID 95986397) has the molecular formula C12H12F2N2O2S and a molecular weight of 286.30 g/mol. Its IUPAC name is (3S)-N-(2,5-difluorophenyl)-5-oxo-1,4-thiazepane-3-carboxamide.
| Compound Name | (3S)-N-(2,5-difluorophenyl)-5-oxo-1,4-thiazepane-3-carboxamide |
|---|---|
| PubChem CID | 95986397 |
| Molecular Formula | C12H12F2N2O2S |
| Molecular Weight | 286.30 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | (3S)-N-(2,5-difluorophenyl)-5-oxo-1,4-thiazepane-3-carboxamide |
| SMILES | O=C1CCSC[C@H](C(=O)Nc2cc(F)ccc2F)N1 |
| InChI | InChI=1S/C12H12F2N2O2S/c13-7-1-2-8(14)9(5-7)16-12(18)10-6-19-4-3-11(17)15-10/h1-2,5,10H,3-4,6H2,(H,15,17)(H,16,18)/t10-/m1/s1 |
| InChIKey | GZOGLLJMDZPWTL-SNVBAGLBSA-N |
| XLogP | 1.52 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.30 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |