C13H14N2O4S — CID 71798048
N-(1,3-benzodioxol-5-yl)-5-oxo-1,4-thiazepane-3-carboxamide (PubChem CID 71798048) has the molecular formula C13H14N2O4S and a molecular weight of 294.33 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-5-oxo-1,4-thiazepane-3-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-5-oxo-1,4-thiazepane-3-carboxamide |
|---|---|
| PubChem CID | 71798048 |
| Molecular Formula | C13H14N2O4S |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-5-oxo-1,4-thiazepane-3-carboxamide |
| SMILES | O=C1CCSCC(C(=O)Nc2ccc3c(c2)OCO3)N1 |
| InChI | InChI=1S/C13H14N2O4S/c16-12-3-4-20-6-9(15-12)13(17)14-8-1-2-10-11(5-8)19-7-18-10/h1-2,5,9H,3-4,6-7H2,(H,14,17)(H,15,16) |
| InChIKey | JJDYVWRZVXVRDF-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |