C13H15NO3S — CID 110863209
N-(1,3-benzodioxol-5-yl)thiane-3-carboxamide (PubChem CID 110863209) has the molecular formula C13H15NO3S and a molecular weight of 265.33 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)thiane-3-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)thiane-3-carboxamide |
|---|---|
| PubChem CID | 110863209 |
| Molecular Formula | C13H15NO3S |
| Molecular Weight | 265.33 g/mol |
| Exact Mass | 265.08 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)thiane-3-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)OCO2)C1CCCSC1 |
| InChI | InChI=1S/C13H15NO3S/c15-13(9-2-1-5-18-7-9)14-10-3-4-11-12(6-10)17-8-16-11/h3-4,6,9H,1-2,5,7-8H2,(H,14,15) |
| InChIKey | FGGSSXFSEUUTPC-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.33 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |