C12H14N2O3 — CID 22691464
(2S)-N-(1,3-benzodioxol-5-yl)pyrrolidine-2-carboxamide (PubChem CID 22691464) has the molecular formula C12H14N2O3 and a molecular weight of 234.25 g/mol. Its IUPAC name is (2S)-N-(1,3-benzodioxol-5-yl)pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-(1,3-benzodioxol-5-yl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 22691464 |
| Molecular Formula | C12H14N2O3 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | (2S)-N-(1,3-benzodioxol-5-yl)pyrrolidine-2-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)OCO2)[C@@H]1CCCN1 |
| InChI | InChI=1S/C12H14N2O3/c15-12(9-2-1-5-13-9)14-8-3-4-10-11(6-8)17-7-16-10/h3-4,6,9,13H,1-2,5,7H2,(H,14,15)/t9-/m0/s1 |
| InChIKey | AISQTYVQQCYXGI-VIFPVBQESA-N |
| XLogP | 1.11 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |