C14H17N3O3 — CID 119279066
N-(3-oxo-4H-1,4-benzoxazin-7-yl)piperidine-2-carboxamide (PubChem CID 119279066) has the molecular formula C14H17N3O3 and a molecular weight of 275.31 g/mol. Its IUPAC name is N-(3-oxo-4H-1,4-benzoxazin-7-yl)piperidine-2-carboxamide.
| Compound Name | N-(3-oxo-4H-1,4-benzoxazin-7-yl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 119279066 |
| Molecular Formula | C14H17N3O3 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | N-(3-oxo-4H-1,4-benzoxazin-7-yl)piperidine-2-carboxamide |
| SMILES | O=C1COc2cc(NC(=O)C3CCCCN3)ccc2N1 |
| InChI | InChI=1S/C14H17N3O3/c18-13-8-20-12-7-9(4-5-10(12)17-13)16-14(19)11-3-1-2-6-15-11/h4-5,7,11,15H,1-3,6,8H2,(H,16,19)(H,17,18) |
| InChIKey | WGAJLRPYXGPYDL-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |