C14H18N2O3 — CID 24708049
N-(2,3-dihydro-1,4-benzodioxin-6-yl)piperidine-2-carboxamide (PubChem CID 24708049) has the molecular formula C14H18N2O3 and a molecular weight of 262.31 g/mol. Its IUPAC name is N-(2,3-dihydro-1,4-benzodioxin-6-yl)piperidine-2-carboxamide.
| Compound Name | N-(2,3-dihydro-1,4-benzodioxin-6-yl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 24708049 |
| Molecular Formula | C14H18N2O3 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | N-(2,3-dihydro-1,4-benzodioxin-6-yl)piperidine-2-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)OCCO2)C1CCCCN1 |
| InChI | InChI=1S/C14H18N2O3/c17-14(11-3-1-2-6-15-11)16-10-4-5-12-13(9-10)19-8-7-18-12/h4-5,9,11,15H,1-3,6-8H2,(H,16,17) |
| InChIKey | RAVAWKLPBUAKSN-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |