C16H21N3O3 — CID 78893386
1-(2-cyclopentylethyl)-3-(3-oxo-4H-1,4-benzoxazin-7-yl)urea (PubChem CID 78893386) has the molecular formula C16H21N3O3 and a molecular weight of 303.36 g/mol. Its IUPAC name is 1-(2-cyclopentylethyl)-3-(3-oxo-4H-1,4-benzoxazin-7-yl)urea.
| Compound Name | 1-(2-cyclopentylethyl)-3-(3-oxo-4H-1,4-benzoxazin-7-yl)urea |
|---|---|
| PubChem CID | 78893386 |
| Molecular Formula | C16H21N3O3 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | 1-(2-cyclopentylethyl)-3-(3-oxo-4H-1,4-benzoxazin-7-yl)urea |
| SMILES | O=C1COc2cc(NC(=O)NCCC3CCCC3)ccc2N1 |
| InChI | InChI=1S/C16H21N3O3/c20-15-10-22-14-9-12(5-6-13(14)19-15)18-16(21)17-8-7-11-3-1-2-4-11/h5-6,9,11H,1-4,7-8,10H2,(H,19,20)(H2,17,18,21) |
| InChIKey | PVGQXVOVZSTNPO-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |