C18H26N4O3 — CID 78893346
1-[1-(2-methylpropyl)piperidin-4-yl]-3-(3-oxo-4H-1,4-benzoxazin-7-yl)urea (PubChem CID 78893346) has the molecular formula C18H26N4O3 and a molecular weight of 346.43 g/mol. Its IUPAC name is 1-[1-(2-methylpropyl)piperidin-4-yl]-3-(3-oxo-4H-1,4-benzoxazin-7-yl)urea.
| Compound Name | 1-[1-(2-methylpropyl)piperidin-4-yl]-3-(3-oxo-4H-1,4-benzoxazin-7-yl)urea |
|---|---|
| PubChem CID | 78893346 |
| Molecular Formula | C18H26N4O3 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | 1-[1-(2-methylpropyl)piperidin-4-yl]-3-(3-oxo-4H-1,4-benzoxazin-7-yl)urea |
| SMILES | CC(C)CN1CCC(NC(=O)Nc2ccc3c(c2)OCC(=O)N3)CC1 |
| InChI | InChI=1S/C18H26N4O3/c1-12(2)10-22-7-5-13(6-8-22)19-18(24)20-14-3-4-15-16(9-14)25-11-17(23)21-15/h3-4,9,12-13H,5-8,10-11H2,1-2H3,(H,21,23)(H2,19,20,24) |
| InChIKey | CWRSJNIQLVWUKJ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |