C18H19N3O3 — CID 78893226
1-[1-(2-methylphenyl)ethyl]-3-(3-oxo-4H-1,4-benzoxazin-7-yl)urea (PubChem CID 78893226) has the molecular formula C18H19N3O3 and a molecular weight of 325.37 g/mol. Its IUPAC name is 1-[1-(2-methylphenyl)ethyl]-3-(3-oxo-4H-1,4-benzoxazin-7-yl)urea.
| Compound Name | 1-[1-(2-methylphenyl)ethyl]-3-(3-oxo-4H-1,4-benzoxazin-7-yl)urea |
|---|---|
| PubChem CID | 78893226 |
| Molecular Formula | C18H19N3O3 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | 1-[1-(2-methylphenyl)ethyl]-3-(3-oxo-4H-1,4-benzoxazin-7-yl)urea |
| SMILES | Cc1ccccc1C(C)NC(=O)Nc1ccc2c(c1)OCC(=O)N2 |
| InChI | InChI=1S/C18H19N3O3/c1-11-5-3-4-6-14(11)12(2)19-18(23)20-13-7-8-15-16(9-13)24-10-17(22)21-15/h3-9,12H,10H2,1-2H3,(H,21,22)(H2,19,20,23) |
| InChIKey | BZLUFZVBAKMNLQ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |