C17H18N2O3 — CID 51301780
1-(1,3-benzodioxol-5-yl)-3-[1-(2-methylphenyl)ethyl]urea (PubChem CID 51301780) has the molecular formula C17H18N2O3 and a molecular weight of 298.34 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-3-[1-(2-methylphenyl)ethyl]urea.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-3-[1-(2-methylphenyl)ethyl]urea |
|---|---|
| PubChem CID | 51301780 |
| Molecular Formula | C17H18N2O3 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-3-[1-(2-methylphenyl)ethyl]urea |
| SMILES | Cc1ccccc1C(C)NC(=O)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H18N2O3/c1-11-5-3-4-6-14(11)12(2)18-17(20)19-13-7-8-15-16(9-13)22-10-21-15/h3-9,12H,10H2,1-2H3,(H2,18,19,20) |
| InChIKey | CKWKKTAIVPZENS-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |