C13H18N2O3 — CID 47132811
1-(1,3-benzodioxol-5-yl)-3-pentan-3-ylurea (PubChem CID 47132811) has the molecular formula C13H18N2O3 and a molecular weight of 250.30 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-3-pentan-3-ylurea.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-3-pentan-3-ylurea |
|---|---|
| PubChem CID | 47132811 |
| Molecular Formula | C13H18N2O3 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-3-pentan-3-ylurea |
| SMILES | CCC(CC)NC(=O)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C13H18N2O3/c1-3-9(4-2)14-13(16)15-10-5-6-11-12(7-10)18-8-17-11/h5-7,9H,3-4,8H2,1-2H3,(H2,14,15,16) |
| InChIKey | YBBILPOEDNCVOK-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |