C14H18N2O5 — CID 103927435
(2R)-2-(1,3-benzodioxol-5-ylcarbamoylamino)-3,3-dimethylbutanoic acid (PubChem CID 103927435) has the molecular formula C14H18N2O5 and a molecular weight of 294.31 g/mol. Its IUPAC name is (2R)-2-(1,3-benzodioxol-5-ylcarbamoylamino)-3,3-dimethylbutanoic acid.
| Compound Name | (2R)-2-(1,3-benzodioxol-5-ylcarbamoylamino)-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 103927435 |
| Molecular Formula | C14H18N2O5 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | (2R)-2-(1,3-benzodioxol-5-ylcarbamoylamino)-3,3-dimethylbutanoic acid |
| SMILES | CC(C)(C)[C@@H](NC(=O)Nc1ccc2c(c1)OCO2)C(=O)O |
| InChI | InChI=1S/C14H18N2O5/c1-14(2,3)11(12(17)18)16-13(19)15-8-4-5-9-10(6-8)21-7-20-9/h4-6,11H,7H2,1-3H3,(H,17,18)(H2,15,16,19)/t11-/m0/s1 |
| InChIKey | MMPSOGOMGAPJLL-NSHDSACASA-N |
| XLogP | 2.04 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |