C14H18N2O5 — CID 79814694
2-(1,3-benzodioxol-5-ylcarbamoylamino)-2-ethylbutanoic acid (PubChem CID 79814694) has the molecular formula C14H18N2O5 and a molecular weight of 294.31 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-ylcarbamoylamino)-2-ethylbutanoic acid.
| Compound Name | 2-(1,3-benzodioxol-5-ylcarbamoylamino)-2-ethylbutanoic acid |
|---|---|
| PubChem CID | 79814694 |
| Molecular Formula | C14H18N2O5 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 2-(1,3-benzodioxol-5-ylcarbamoylamino)-2-ethylbutanoic acid |
| SMILES | CCC(CC)(NC(=O)Nc1ccc2c(c1)OCO2)C(=O)O |
| InChI | InChI=1S/C14H18N2O5/c1-3-14(4-2,12(17)18)16-13(19)15-9-5-6-10-11(7-9)21-8-20-10/h5-7H,3-4,8H2,1-2H3,(H,17,18)(H2,15,16,19) |
| InChIKey | MEIFIZJAJFTTMX-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |