C13H17NO3 — CID 803627
N-(1,3-benzodioxol-5-yl)-3,3-dimethylbutanamide (PubChem CID 803627) has the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-3,3-dimethylbutanamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 803627 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-3,3-dimethylbutanamide |
| SMILES | CC(C)(C)CC(=O)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C13H17NO3/c1-13(2,3)7-12(15)14-9-4-5-10-11(6-9)17-8-16-10/h4-6H,7-8H2,1-3H3,(H,14,15) |
| InChIKey | PBNQGWUUPOQXLC-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |