C15H23N2O3+ — CID 2379667
[2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl]-triethylazanium (PubChem CID 2379667) has the molecular formula C15H23N2O3+ and a molecular weight of 279.36 g/mol. Its IUPAC name is [2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl]-triethylazanium.
| Compound Name | [2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl]-triethylazanium |
|---|---|
| PubChem CID | 2379667 |
| Molecular Formula | C15H23N2O3+ |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.17 |
| IUPAC Name | [2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl]-triethylazanium |
| SMILES | CC[N+](CC)(CC)CC(=O)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H22N2O3/c1-4-17(5-2,6-3)10-15(18)16-12-7-8-13-14(9-12)20-11-19-13/h7-9H,4-6,10-11H2,1-3H3/p+1 |
| InChIKey | KARXHMWWVQEURC-UHFFFAOYSA-O |
| XLogP | 2.23 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|