C13H18N2O3S — CID 134064800
N-(1,3-benzodioxol-5-yl)-2-[2-(dimethylamino)ethylsulfanyl]acetamide (PubChem CID 134064800) has the molecular formula C13H18N2O3S and a molecular weight of 282.37 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-2-[2-(dimethylamino)ethylsulfanyl]acetamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-2-[2-(dimethylamino)ethylsulfanyl]acetamide |
|---|---|
| PubChem CID | 134064800 |
| Molecular Formula | C13H18N2O3S |
| Molecular Weight | 282.37 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-2-[2-(dimethylamino)ethylsulfanyl]acetamide |
| SMILES | CN(C)CCSCC(=O)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C13H18N2O3S/c1-15(2)5-6-19-8-13(16)14-10-3-4-11-12(7-10)18-9-17-11/h3-4,7H,5-6,8-9H2,1-2H3,(H,14,16) |
| InChIKey | YHNSTIOLHWBQLX-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.37 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|