C13H15NO5S — CID 8785432
methyl 3-[2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl]sulfanylpropanoate (PubChem CID 8785432) has the molecular formula C13H15NO5S and a molecular weight of 297.33 g/mol. Its IUPAC name is methyl 3-[2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl]sulfanylpropanoate.
| Compound Name | methyl 3-[2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl]sulfanylpropanoate |
|---|---|
| PubChem CID | 8785432 |
| Molecular Formula | C13H15NO5S |
| Molecular Weight | 297.33 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | methyl 3-[2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl]sulfanylpropanoate |
| SMILES | COC(=O)CCSCC(=O)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C13H15NO5S/c1-17-13(16)4-5-20-7-12(15)14-9-2-3-10-11(6-9)19-8-18-10/h2-3,6H,4-5,7-8H2,1H3,(H,14,15) |
| InChIKey | PIYNCOAESXZBQG-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.33 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|