C10H11NO3S — CID 8700974
N-(1,3-benzodioxol-5-yl)-2-methylsulfanylacetamide (PubChem CID 8700974) has the molecular formula C10H11NO3S and a molecular weight of 225.27 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-2-methylsulfanylacetamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-2-methylsulfanylacetamide |
|---|---|
| PubChem CID | 8700974 |
| Molecular Formula | C10H11NO3S |
| Molecular Weight | 225.27 g/mol |
| Exact Mass | 225.05 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-2-methylsulfanylacetamide |
| SMILES | CSCC(=O)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C10H11NO3S/c1-15-5-10(12)11-7-2-3-8-9(4-7)14-6-13-8/h2-4H,5-6H2,1H3,(H,11,12) |
| InChIKey | KWQGQDAGMDKGIK-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.27 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |