C10H12N4O3S — CID 77060708
[2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl] N'-aminocarbamimidothioate (PubChem CID 77060708) has the molecular formula C10H12N4O3S and a molecular weight of 268.30 g/mol. Its IUPAC name is [2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl] N'-aminocarbamimidothioate.
| Compound Name | [2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl] N'-aminocarbamimidothioate |
|---|---|
| PubChem CID | 77060708 |
| Molecular Formula | C10H12N4O3S |
| Molecular Weight | 268.30 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | [2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl] N'-aminocarbamimidothioate |
| SMILES | NN=C(N)SCC(=O)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C10H12N4O3S/c11-10(14-12)18-4-9(15)13-6-1-2-7-8(3-6)17-5-16-7/h1-3H,4-5,12H2,(H2,11,14)(H,13,15) |
| InChIKey | WESWQTYUOMPESQ-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 111.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.30 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|