C9H8N4O3 — CID 52940396
2-azido-N-(1,3-benzodioxol-5-yl)acetamide (PubChem CID 52940396) has the molecular formula C9H8N4O3 and a molecular weight of 220.19 g/mol. Its IUPAC name is 2-azido-N-(1,3-benzodioxol-5-yl)acetamide.
| Compound Name | 2-azido-N-(1,3-benzodioxol-5-yl)acetamide |
|---|---|
| PubChem CID | 52940396 |
| Molecular Formula | C9H8N4O3 |
| Molecular Weight | 220.19 g/mol |
| Exact Mass | 220.06 |
| IUPAC Name | 2-azido-N-(1,3-benzodioxol-5-yl)acetamide |
| SMILES | [N-]=[N+]=NCC(=O)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C9H8N4O3/c10-13-11-4-9(14)12-6-1-2-7-8(3-6)16-5-15-7/h1-3H,4-5H2,(H,12,14) |
| InChIKey | KTAGRQPCBGVHPL-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 96.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.19 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|