C14H18N2O4S — CID 9344458
methyl 3-[2-[4-(methylcarbamoyl)anilino]-2-oxoethyl]sulfanylpropanoate (PubChem CID 9344458) has the molecular formula C14H18N2O4S and a molecular weight of 310.38 g/mol. Its IUPAC name is methyl 3-[2-[4-(methylcarbamoyl)anilino]-2-oxoethyl]sulfanylpropanoate.
| Compound Name | methyl 3-[2-[4-(methylcarbamoyl)anilino]-2-oxoethyl]sulfanylpropanoate |
|---|---|
| PubChem CID | 9344458 |
| Molecular Formula | C14H18N2O4S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | methyl 3-[2-[4-(methylcarbamoyl)anilino]-2-oxoethyl]sulfanylpropanoate |
| SMILES | CNC(=O)c1ccc(NC(=O)CSCCC(=O)OC)cc1 |
| InChI | InChI=1S/C14H18N2O4S/c1-15-14(19)10-3-5-11(6-4-10)16-12(17)9-21-8-7-13(18)20-2/h3-6H,7-9H2,1-2H3,(H,15,19)(H,16,17) |
| InChIKey | OKFOWGIGJBJMKH-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|